On Target PDE4B_HUMAN 0.3006135/CHEMBL383225
For the given ligand Rf Furano, we have found in our database that, being scored 0.3006135, the most similar ligand is CHEMBL383225. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL383225 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | CC(C)(C#N)c1cc(c2cccc(CN(C(=O)c3ccccc3)c4ccc(cc4)S(=O)(=O)C)c2)c5ncccc5c1 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00006002 00806a00 00024100 00910610 00041001 04000008 10000000 02001008 00000000 00080840 08282004 6000c000 00008802 00500000 80200440 800c000c 04462000 02001004 0c200000 00082000 c0100000 08028608 30812400 8840001d 00040001 c0080080 08000200 808000c1 0040c100 00060003 80040000 000106a0 |