On Target NOS1_HUMAN 0.34586465/CHEMBL96680
For the given ligand Rf Furano, we have found in our database that, being scored 0.34586465, the most similar ligand is CHEMBL96680. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL96680 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | NCc1cccc(NC(=N)c2occc2)c1 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00884082 00200010 40080100 00010600 04000000 08000000 00000000 02201000 01804100 00000853 00200024 4000d000 44000c80 00000008 00000060 00080000 00044000 02000000 08000008 00000000 41120000 08028000 20010000 00480000 00840820 80000000 44100010 88000080 00408118 00860000 00040000 04000200 |