On Target AOFB_HUMAN 0.37383178/CHEMBL338404
For the given ligand Rf Furano, we have found in our database that, being scored 0.37383178, the most similar ligand is CHEMBL338404. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL338404 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | NCCNC(=O)c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00008000 00002800 00000100 00010600 00000000 00000000 00000000 02001000 00000000 00090840 00200000 40008800 02008846 00000000 00000400 00000000 00000000 02000000 00000000 00000000 00000000 28028700 00000000 0240000c 00002000 c0000000 00040000 80000000 08000100 00060001 80040000 00020200 |