On Target NMDE2_HUMAN 0.29281768/CHEMBL2013206
For the given ligand Rf Furano, we have found in our database that, being scored 0.29281768, the most similar ligand is CHEMBL2013206. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL2013206 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | Oc1ccc2[nH]c(nc2c1CNCc3occc3)c4cccc(F)c4F |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 10010082 0020080c 20180304 12050610 04040060 00004010 06004000 02281400 00004100 10102850 41208034 50009000 44010c06 00409008 00020460 020c200c 00027208 02002008 00200000 40460000 41000000 28008820 21800000 00480100 00846020 c0000000 04102050 88000001 00000104 00468c00 44048800 806402a0 |