On Target P2RX3_HUMAN 0.3283582/CHEMBL3679809
For the given ligand Rf Furano, we have found in our database that, being scored 0.3283582, the most similar ligand is CHEMBL3679809. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL3679809 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | CC(C)C(=O)C1C(N(C(=O)C1=O)c2ccc(cc2)c3oc(C)cc3)c4ccccc4S(=O)(=O)C |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 0043e003 01a01a08 001a0102 00910600 20040000 00206030 00000000 22a41000 04104900 080808c0 08382024 7019f000 5e008c0a 04308000 80220460 00000000 04064080 02000801 0c002218 1000a201 c0340100 1c068630 30812020 08580019 00003800 d0000080 04000010 980000c0 0000c102 00070003 60045140 00c14620 |