On Target DRD4_HUMAN 0.4864865/CHEMBL139926
For the given ligand Rf Furano, we have found in our database that, being scored 0.4864865, the most similar ligand is CHEMBL139926. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL139926 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | Clc1cccc(N2CCN(CCCCNC(=O)c3oc4ccccc4c3)CC2)c1Cl |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 0001c082 00201800 00180120 05010600 04000200 00000000 08000000 6a201200 02204100 00000ac0 00200034 40029800 46008c0e 00002089 00000460 00000000 00044000 12000000 08000000 00004201 40100000 38068708 20000021 0249021e 08802020 e0100400 04100014 98000080 0800a180 01060001 a0040000 00020200 |