On Target OPRD_HUMAN 0.51754385/CHEMBL339621
For the given ligand Rf Furano, we have found in our database that, being scored 0.51754385, the most similar ligand is CHEMBL339621. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL339621 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | CCN(CC)S(=O)(=O)c1ccc(cc1)C(N2CCNCC2)c3ccccc3 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00000010 00801000 01000100 05b10600 00080008 00000000 00000000 03001000 00000000 00090840 08202000 60008000 00000802 00002001 80200400 00000000 00002000 02000000 00400000 00006000 80000000 280c8000 00000020 0a400018 02000000 e0000004 00000000 c000002c 08000580 20060002 00040000 00010660 |