On Target NMDZ1_HUMAN 0.30722892/CHEMBL159739
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.30722892, the most similar ligand is CHEMBL159739. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL159739 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CNC(=O)NS(=O)(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 10018012 09800800 01000100 12b10e10 000c1020 0000c020 0c004080 0a003000 00000300 00082848 01282004 e0008c00 0200888c 00708441 802200c0 020c000c 0204a008 0280000c 00600000 00006000 c0022080 08078fe8 20802002 8840010c 00046000 80000400 88040000 8000040c 00000504 20060001 c0048200 80430260 |