On Target PERM_HUMAN 0.40366971/CHEMBL86
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.40366971, the most similar ligand is CHEMBL86. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL86 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00008002 88002808 20000108 84010600 00001000 00020100 06000000 02001408 00000000 00110848 08200004 40008800 02008806 08002000 81000441 00002008 00000000 02000400 00000000 00020400 40000000 28028700 20000000 0240000c 00002000 c0000400 00100800 80000000 08000300 00060801 84040000 00020200 |