On Target ACES_HUMAN 0.48192772/CHEMBL1669479
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.48192772, the most similar ligand is CHEMBL1669479. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL1669479 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | [Cl-].[Cl-].C[N+](C)(CCNC(=O)C(=O)NCC[N+](C)(C)Cc1ccccc1Cl)Cc2ccccc2Cl |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00008000 00002000 00000100 04010600 00000000 00000000 00000000 02001008 04000000 00010840 00200000 4000a800 02008806 00002001 00000400 00000000 00000000 02000000 00000000 00000000 00000800 28008700 00000002 02400008 00002000 c0000200 00000000 80000100 08000100 00060001 08044000 00020200 |