On Target PDE5A_HUMAN 0.2815534/CHEMBL493552
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.2815534, the most similar ligand is CHEMBL493552. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL493552 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCOC(=O)c1sc(Nc2nc(NCc3ccc(cc3)S(=O)(=O)N)cc(n2)N4CCNCC4)nc1C |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00030012 42801001 010009a0 2cb90610 03000448 0000e000 0050a980 120698c8 30002100 00000a50 00202a04 7000d800 0400880a 00212001 80222900 101c000c 01061000 02004080 00410010 84a07000 80102000 2e0caa80 20914860 3a71001e 020c1480 8c100080 00280401 b00004ec 0d28031d 244e2800 c0041000 042102e0 |