On Target FABP5_HUMAN 0.19186047/CHEMBL3950316
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.19186047, the most similar ligand is CHEMBL3950316. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3950316 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | Cc1cc(Cl)cc2c(c3ccccc3)c(C(=O)O)c(nc12)N4CCCCC4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 1801e002 01800801 40104180 00010610 20041005 0001e040 14000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 a0020840 000c000e 00060000 02004004 0c200000 10a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |