On Target PAR1_HUMAN 0.37288135/CHEMBL3658415
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.37288135, the most similar ligand is CHEMBL3658415. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3658415 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | Cc1ccc(cc1C)C2CC(CN(C2)C(=O)C3(N)CCC3)NC(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00010000 01003a00 00100102 04010600 00001001 00000000 00000000 2200100c 00300980 000908c0 08300000 5003b800 04008802 00202010 00000400 000c0008 00000000 02000000 00000000 00000201 00000100 38268600 01000003 8350001c 00000000 c0000000 00000000 90000000 0c000100 0006000b a0040000 00002600 |