On Target SC6A4_HUMAN 0.575/CHEMBL565639
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.575, the most similar ligand is CHEMBL565639. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL565639 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)N([C@@H]1CCNC1)C(=O)c2ccc3ccccc3c2 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000000 00003c00 00100100 04010600 00000000 00000010 00000000 02001008 00000000 000109e0 00200000 40008000 00008802 00002000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 380a8608 00000000 0240001c 00000000 c0000000 00000000 80000000 08000100 00060011 a0040000 00000200 |