On Target MK01_HUMAN 0.4489796/CHEMBL1990254
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.4489796, the most similar ligand is CHEMBL1990254. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL1990254 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NCC(NC(=O)c1ccc(cc1)c2ccncc2)c3ccccc3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002002 00802800 00004100 40010600 00040000 00000000 00000000 02001000 00000100 00090840 08200004 60008000 80008802 00000000 00000400 00040004 00022000 02000000 04200000 10000000 c0000000 38028600 30800000 8340001c 00000000 c0000000 00000000 80000040 0c004100 00060003 80040000 00000620 |