On Target HYES_HUMAN 0.7307692/CHEMBL381544
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.7307692, the most similar ligand is CHEMBL381544. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL381544 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)(C)c1ccc(cc1)C(=O)NCc2ccc(cc2)S(=O)(=O)N |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000010 00801800 01000100 40b10600 00000008 00000000 00000000 02001000 00000100 00080840 08202000 60008800 80008802 00000001 80200400 00000000 00002000 02000000 00000000 00002000 80000000 080a8600 00000000 0840001c 00000000 c0000000 00000000 80000028 00000100 20060003 80040000 00010620 |