On Target TRPV3_HUMAN 0.29285714/CHEMBL3696375
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.29285714, the most similar ligand is CHEMBL3696375. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3696375 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)[C@H](CO)NCc1ccnc(n1)c2ccc(cc2)S(=O)(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 0000001a 00801a00 00120108 10950e00 000000a0 00104002 00401000 08083049 00000100 10000840 00212004 60008800 01000002 00318000 80220400 000c040c 14000008 02002022 80400000 00402201 80400000 18018000 23800040 08400119 00004000 c0000400 00000000 80201020 00000104 00660400 60008800 000102a0 |