On Target AMPN_HUMAN 0.34065935/CHEMBL3805986
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.34065935, the most similar ligand is CHEMBL3805986. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3805986 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NC(CNCc1ccccc1)P(=O)(O)O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000400 00000600 00000100 00010620 00004000 00000000 00000000 02001000 00000000 00010840 00200000 40008000 00000802 00020000 00000400 00000000 00000028 02000000 00000000 00000000 00000000 2d308000 00800000 02400000 00002002 c0000000 00000000 80014000 08080100 00060000 20840000 00008223 |