On Target AOFA_HUMAN 0.4368932/CHEMBL2158251
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.4368932, the most similar ligand is CHEMBL2158251. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL2158251 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)CCSc1ccc2C(=O)NC(=O)c2c1 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000000 00801a00 80020100 10110600 00000020 00018000 00000000 02001000 05000000 00004840 00600001 60008040 00018802 00250000 02000480 00000000 04002000 02000001 00114000 00000001 80020000 080a8680 00800120 0040001d 00002000 c0200000 00000000 80000000 00000100 00060001 90040000 01010220 |