On Target GLRA3_HUMAN 0.21105528/CHEMBL4074873
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.21105528, the most similar ligand is CHEMBL4074873. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL4074873 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CN1C(=O)[C@@H]2CN(C[C@@H]2c3cnccc13)S(=O)(=O)c4ccc5occc5c4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00020052 22a04600 01184100 01b00610 200c1200 00002050 1201a000 40200200 00604880 004909e0 00382034 60029000 4c008c03 00100981 80e20000 00040006 0004e004 0a000004 00600418 00007e03 e0100100 18248608 20804000 99480018 0a041800 0100000c 08028010 1800108c 04482400 21060a1b 00000080 20812670 |