On Target PPARG_HUMAN 0.48305085/CHEMBL3678104
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.48305085, the most similar ligand is CHEMBL3678104. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3678104 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCC(NC(=O)c1ccc2c(ccn2S(=O)(=O)c3ccc(C)cc3)c1)c4ccccc4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000012 00809800 21102100 00b10640 00040008 00000000 40000000 02001400 00000800 00080840 08302004 60008000 00009802 00440001 84200441 00040004 00002000 02000104 00600000 00022201 c0000100 18068608 20800050 8840001c 00800000 c0000000 20000040 80000028 00404100 20060023 a0040200 00010620 |