On Target CASP1_HUMAN 0.48/CHEMBL589552
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.48, the most similar ligand is CHEMBL589552. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL589552 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00048000 00003800 00100100 04010600 00000000 00000000 00000000 22001008 00000000 000108c0 00200000 4000b000 0e008802 00002001 80000400 00080008 00000000 02000001 00c00010 00000201 00000000 38128e08 01000083 0240001c 00001001 c0000000 00000000 90000000 08000102 00060001 a0044000 00002200 |