On Target PPAP_HUMAN 0.3030303/CHEMBL68858
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.3030303, the most similar ligand is CHEMBL68858. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL68858 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | OP(=O)(O)C(NCc1ccccc1)c2cccc3ccccc23 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00000840 00200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308008 00000000 00400000 00000000 c6010006 00000000 80014000 00000100 30060000 00040000 00008203 |