On Target DRD2_HUMAN 0.5344828/CHEMBL26
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.5344828, the most similar ligand is CHEMBL26. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL26 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCN1CCCC1CNC(=O)c2cc(ccc2OC)S(=O)(=O)N |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000010 01807809 21104108 04b10600 00001120 00030110 02000000 22001408 01000000 001108c0 08202000 60018000 00008802 00002001 81200481 00002108 00000000 02000000 00010800 00022201 80000000 38068620 00000001 0a50001c 00000000 c0000000 00800800 90000088 08000300 20060001 a4040000 40010220 |