On Target HPGDS_HUMAN 0.45360824/CHEMBL2035656
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.45360824, the most similar ligand is CHEMBL2035656. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL2035656 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NCc1ccc2ccccc2c1c3ccc(cc3)C(=O)NCCN4CCOCC4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002000 00002801 00000100 d4010600 00000080 00000000 00000000 02001008 00000100 10010840 00200000 40008000 80008802 00202000 20101408 00080108 10020000 02000000 04000000 10400000 00000000 28028608 12000000 0240000c 00000400 c0000000 00000000 80000041 08004300 00060001 80040000 00000200 |