On Target NK1R_HUMAN 0.43434343/CHEMBL106555
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.43434343, the most similar ligand is CHEMBL106555. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL106555 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CN1CCN(C(C1)c2ccccc2)C(=O)CNC3CCN(Cc4ccccc4)CC3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000000 01802400 00100100 04010600 00000000 00000000 00000000 22001008 00000080 000909e0 08200000 5001a000 02008802 00002000 80000400 00000000 00000000 02000000 00000000 00000201 80000000 38208600 00000023 83500018 00000000 c0000000 00000000 90000000 0c000100 00060013 20044000 00000600 |