On Target ALDR_HUMAN 0.36764705/CHEMBL279878
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.36764705, the most similar ligand is CHEMBL279878. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL279878 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NS(=O)(=O)c1ccc(Cl)cc1C2NC(=O)NC2=O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00008011 0d803200 01100100 00b10e00 00080000 10200000 04000004 02003004 00001000 00080948 09202000 6018b800 1f009804 08000001 c0300000 00040000 00004088 02002000 00000020 00002001 80020100 38218700 10180000 89480018 00002000 80000000 10010000 80000008 0c000100 20060003 20046000 80034620 |