On Target AOFB_HUMAN 0.51282054/CHEMBL338404
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.51282054, the most similar ligand is CHEMBL338404. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL338404 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NCCNC(=O)c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00008000 00002800 00000100 00010600 00000000 00000000 00000000 02001000 00000000 00090840 00200000 40008800 02008846 00000000 00000400 00000000 00000000 02000000 00000000 00000000 00000000 28028700 00000000 0240000c 00002000 c0000000 00040000 80000000 08000100 00060001 80040000 00020200 |