On Target PGH1_SHEEP 0.4509804/CHEMBL268643
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.4509804, the most similar ligand is CHEMBL268643. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL268643 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | O=C1NCCCC1N2C(=O)c3ccccc3C2=O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00018000 01803800 00100100 14010600 00000000 00008000 00000080 22001008 00200000 000108c0 00200000 5003b000 06008812 00202000 00000400 00000000 00002000 02000000 00100000 00000201 80020000 38068680 00000001 0240001c 00000000 c0200000 00004000 90000000 08000100 00060001 a0044000 00000200 |