On Target MDR1_HUMAN 0.49425286/CHEMBL2074727
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.49425286, the most similar ligand is CHEMBL2074727. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL2074727 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | [I-].CC[N+](C)(CC)CCNC(=O)c1ccc(cc1)N=[N+]=[N-] |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000002 00002800 00000100 84010600 00004000 00000000 00000000 02001008 00000200 00010840 00200004 40008000 00008802 00002000 00000441 00000000 00008000 02800000 00000000 00000000 44000000 28028600 20000012 0240000c 00800002 c0000000 80000000 80000000 08100100 00060001 80240000 00000200 |