On Target AGTR2_HUMAN 0.3625/CHEMBL39352
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.3625, the most similar ligand is CHEMBL39352. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL39352 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCCC1=NC(C)(C)C(=O)N1Cc2ccc(cc2)c3ccccc3S(=O)(=O)NC(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002052 00801801 01380140 01b90e00 00080000 00000008 14000001 22001000 00000308 20013cd3 10312010 6000b000 80188c02 00000009 80300400 00100000 02022880 02100000 04418000 10006201 80210001 38068680 10008011 0a40081c 02002084 c0000084 c0400000 9400004c 0a004510 20068041 a0045000 00012360 |