On Target P2Y12_HUMAN 0.35795453/CHEMBL591212
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.35795453, the most similar ligand is CHEMBL591212. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL591212 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1cccc(n1)c2ccccc2)C(=O)N3CCN(CC3)S(=O)(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 0003a092 01803800 01104100 15b10f00 001c0021 00100002 00420000 22083049 00000000 100388c0 00292004 6001b000 06008832 01102001 80220400 020c910c 00822000 02002022 04600000 00406201 c0000020 38078e00 31802023 2a50003c 02100400 c0000004 00000250 9000104c 08004704 21260401 a0044802 00814a60 |