On Target PRGR_HUMAN 0.35514018/CHEMBL3094480
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.35514018, the most similar ligand is CHEMBL3094480. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3094480 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCC(Cc1ccc2ccccc2c1)NS(=O)(=O)c3c(C)cc(C)cc3C |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000050 21801000 01000102 01b10600 00080009 00000008 00010000 00000000 00000800 00480840 08102000 60008000 00000001 00200001 80300000 00000008 00002080 02000000 00400000 00006401 80000100 18000008 00000000 99400018 02002000 80000004 00000000 0000002c 04000400 20060002 00000000 00010660 |