On Target AA2AR_HUMAN 0.38793105/CHEMBL1800358
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.38793105, the most similar ligand is CHEMBL1800358. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL1800358 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CN1CCN(CC1)C(=O)c2cccc(c2)c3nc(N)nc(n3)c4ccccc4O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00008000 00002808 a0000100 04010600 01000001 00000000 12000000 02081848 00000100 00010840 80218000 40009800 02008802 00182000 00020400 1808200c 00000800 0a002000 00000000 00220000 00000008 28028600 60002020 0240000d 80000000 c1000000 28000000 80001020 2800010c 00660001 80040800 00000200 |