On Target DRD4_HUMAN 0.5151515/CHEMBL182075
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.5151515, the most similar ligand is CHEMBL182075. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL182075 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CSc1ccc(cc1)c2ccc(cc2)C(=O)NC3CCN(Cc4ccccc4)C3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002000 00803e00 00120100 44110600 00000000 00000010 00000000 2200100c 00000100 000109e0 00200000 60008000 80008802 00012000 00000400 00000000 04020000 02000000 04000000 10000201 80000000 380a8600 10800000 0240001d 00000000 c0000000 00000000 90000040 08004100 00060011 a0040000 00010220 |