On Target PGH2_HUMAN 0.40229884/CHEMBL294715
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.40229884, the most similar ligand is CHEMBL294715. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL294715 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NS(=O)(=O)c1ccc(cc1)c2ccccc2c3ccc(F)cc3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002010 00801001 01100100 02b10200 00800008 00000010 00000000 00000004 00000000 00000840 00002080 60008000 00000000 00201001 a0200000 00000000 00020000 02000000 04000000 00102000 80000000 08000000 10000000 08400008 00000000 80000000 00000000 00000069 00004000 20028000 00000000 00010220 |