On Target ACE_HUMAN 0.42477876/CHEMBL2112767
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.42477876, the most similar ligand is CHEMBL2112767. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL2112767 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | C[C@H](N[C@@H](CNC(=O)c1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00010000 01007800 00100100 04010600 00080080 00000010 00000000 22001008 00000000 000108c0 00202000 4001b000 0e008812 01002003 80180400 00080008 10000000 02000001 00c00010 00000201 00000000 38168e00 03000083 0250001c 00001001 c0000000 00000000 90000000 08000100 00060001 a0044000 00002200 |