On Target 5HT1B_HUMAN 0.4117647/CHEMBL97637
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL97637. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL97637 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | O=S(=O)(Nc1ccc2nccc(N3CCNCC3)c2c1)c4ccc(cc4)c5ccccc5 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00006012 00801000 01004122 04b10600 00040008 00000000 00008000 00000004 00000000 00000ac0 00202004 60008000 00040c02 00402001 80280040 00060004 00062000 02000008 0c600000 00006000 c0100000 28048808 30840060 8ac0001a 00000080 80000000 00008000 000000ec 0800c400 20060000 00040000 00010260 |