On Target TLR4_HUMAN 0.20547946/CHEMBL3823499
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.20547946, the most similar ligand is CHEMBL3823499. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3823499 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3n[nH]c4ccc(F)cc34)c2c1 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000003 04802208 20124000 02900200 01040000 00000030 02808010 00000008 00002100 10004840 8070a004 60008000 00000822 00441000 80600040 000c400e 04040000 00000000 08600002 00222801 c0080000 0c048008 20800800 88200019 00120000 00000080 22048000 008000c1 00008008 00068000 50040000 00014260 |