On Target CNR2_HUMAN 0.5106383/CHEMBL2336558
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.5106383, the most similar ligand is CHEMBL2336558. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL2336558 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CC(C)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c3ccc(C)cc3)cc1 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000010 00801000 01080100 01b10600 00080008 00000000 04000001 02001000 00000100 00081840 08302000 60008800 80000802 00000001 80200400 00000000 00002000 02100000 00400000 00006000 80000000 08008000 00000000 08400018 02000000 c0000004 40000000 8000002c 00000500 20060002 00040000 00010760 |