On Target OPRX_HUMAN 0.39215687/CHEMBL283301
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.39215687, the most similar ligand is CHEMBL283301. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL283301 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CCN1[C@@H]2CCCC[C@H]2N(C3CCN(Cc4ccc5ccccc5c4)CC3)C1=O |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000000 01003400 00100100 04010e00 00000000 00000000 00000004 22003008 00000000 000009e0 00200000 50018000 00009802 00002000 00000400 00000000 00000000 02002000 02002040 00000201 00000100 380d8418 00000001 02500018 00010000 c0000000 00000000 90000000 08000100 00060011 201c0000 00002200 |