On Target 5HT2C_HUMAN 0.49514562/CHEMBL3753894
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.49514562, the most similar ligand is CHEMBL3753894. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3753894 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | CN(C)CCN(Cc1ccccc1)S(=O)(=O)c2ccc(I)cc2 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000090 00800000 01180100 05b10600 00080000 00000000 04020001 02001000 00000000 00011840 00302000 60088000 00000842 02002001 80200440 00008000 00002000 02100000 00600100 00006000 80010040 28008000 00000000 2a400028 02000000 c0000005 40000000 8000000c 08000500 20060000 00240002 00010360 |