On Target PTGES_HUMAN 0.5/CHEMBL3092271
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL3092271. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3092271 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | OC(=O)c1ccc(cc1)S(=O)(=O)N(Cc2ccccc2)Cc3ccc(Oc4ccccc4)cc3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000010 00801808 21080108 01b10600 00081008 00004000 06040001 02001000 00000100 00001840 00302000 60008000 00008802 00000001 81200401 00080008 00002000 02100001 00402000 00026000 80400000 08128a20 00000000 0840000c 02000000 c0000004 40220000 8020002c 00000700 20060000 c0040400 00010360 |