On Target MIF_HUMAN 0.5316456/CHEMBL3409229
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.5316456, the most similar ligand is CHEMBL3409229. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL3409229 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NS(=O)(=O)c1ccc(CN=C=S)cc1 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00000010 00801000 01000100 00b10620 00000008 00000000 00000000 00001000 00000000 00000840 00002000 60008000 00000800 00080001 80200000 00000000 00200800 02000200 00000000 00002000 80000002 28088000 00000000 08400808 00200000 80100000 40000000 00000028 00000000 20060000 00040000 00010028 |