On Target IKKB_HUMAN 0.49473685/CHEMBL397008
For the given ligand Rf Naftalene, we have found in our database that, being scored 0.49473685, the most similar ligand is CHEMBL397008. Check out the elaboration below.
| Rf Naftalene (Given Ligand) | CHEMBL397008 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c4ccc(C(=O)N3CCN(C(=O)c2ccc1ccccc1c2)CC3)cc4 | NC(=O)c1cc(cc(c1N)c2ccc(cc2)S(=O)(=O)N)c3ccccc3 |
|
|
|
|
|
|
| 00000010 00803800 01000100 04b10600 00000008 00000000 00000000 02001008 00000000 00010840 00202000 60008000 00008802 00002001 80200400 00000000 00000000 02000001 00000000 00002000 80000000 280a8608 00000020 0a40000c 00000000 c0000000 00000000 80000028 08000100 20060001 80040000 00010220 | 00002012 00801800 01000100 00b10600 00000009 04010000 00000000 00081004 00000000 00000840 00002004 60008000 00808800 00000001 80220040 08000008 00020000 02003000 04000000 00002000 c0000000 08028600 30000000 0840000c 00000000 80000000 08000000 00000069 10004000 20060000 80040800 40010020 |