On Target PERM_HUMAN 0.36220473/CHEMBL1409565
For the given ligand lvkui19001, we have found in our database that, being scored 0.36220473, the most similar ligand is CHEMBL1409565. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1409565 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C1N(CCN2CCCCC2)C(=S)Nc3ccccc13 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00040002 01000400 00100000 40000600 001c0000 00004020 02000000 20000800 06200101 400c08e0 0120100c 50018000 00009002 00e00000 000008c0 000c0004 40000000 01008100 00600020 01010201 c0000000 38000038 21800041 02300010 0c000000 80000000 20000000 10040000 08004000 00470010 40080000 00010a88 |