On Target PDE5A_HUMAN 0.37288135/CHEMBL557266
For the given ligand lvkui19001, we have found in our database that, being scored 0.37288135, the most similar ligand is CHEMBL557266. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL557266 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | COc1ccc(CN2C(=O)C=Cc3ccc(cc23)c4ccncc4)cc1 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00002002 00000a08 20004108 00010600 00041000 00002060 02040000 00001000 06100000 400008e0 04000004 60018000 80008802 00600000 01100041 0004000c 00020000 02804000 04200000 00020000 40000000 18028018 30800000 81700008 00000000 c0000000 00220040 00040050 04004200 00060008 00040000 00000020 |