On Target COMT_HUMAN 0.32173914/CHEMBL3797305
For the given ligand lvkui19001, we have found in our database that, being scored 0.32173914, the most similar ligand is CHEMBL3797305. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3797305 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | OC1=CN(C=CC1=O)c2nccc3ccccc23 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 00000208 60004000 00000600 400c0008 00004004 04000000 00201000 02108100 800008c0 00020004 00018000 00008804 00400000 00000040 000c000c 00000000 00004004 00200000 00260000 40000020 1c008018 20800800 81300000 06102400 00000000 00000080 00040000 04000008 00060008 40040000 00604000 |