On Target HYES_HUMAN 0.42857143/CHEMBL2392749
For the given ligand lvkui19001, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL2392749. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2392749 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(Nc1cccnc1)NC23CC4CC(CC(C4)C2)C3 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000006 01801000 00104000 00000e20 00040000 08000000 00000004 00002001 00000000 400000c0 00280004 40010000 00009800 00300000 00000002 00040004 00040000 00400008 8a202000 00000005 40000100 18058410 20822000 00100018 01110002 00000000 00000400 10000080 00000000 00460001 000a0000 00004280 |