On Target TRPV3_HUMAN 0.27702704/CHEMBL3696458
For the given ligand lvkui19001, we have found in our database that, being scored 0.27702704, the most similar ligand is CHEMBL3696458. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3696458 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CC(CCO)CNCc1nc(ccc1F)N2Cc3ccccc3C2 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004082 00000000 00104100 16010e00 01140020 00100020 00800000 22003001 00000900 200808c0 00212004 4000c000 00000802 00201000 00020400 020c010d 02042200 02006002 08600000 00a00201 40120000 1c01a000 21810800 20600010 00100000 c0200080 000000c0 90000081 0040810c 00060800 20041820 40004a00 |